C27H41F2NO4 — CID 68988402
4-[(2,3-difluoro-4-nonylphenyl)methyl-methylamino]-1-ethoxycarbonylcyclohexane-1-carboxylic acid (PubChem CID 68988402) has the molecular formula C27H41F2NO4 and a molecular weight of 481.62 g/mol. Its IUPAC name is 4-[(2,3-difluoro-4-nonylphenyl)methyl-methylamino]-1-ethoxycarbonylcyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2,3-difluoro-4-nonylphenyl)methyl-methylamino]-1-ethoxycarbonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 68988402 |
| Molecular Formula | C27H41F2NO4 |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | 4-[(2,3-difluoro-4-nonylphenyl)methyl-methylamino]-1-ethoxycarbonylcyclohexane-1-carboxylic acid |
| SMILES | CCCCCCCCCc1ccc(CN(C)C2CCC(C(=O)O)(C(=O)OCC)CC2)c(F)c1F |
| InChI | InChI=1S/C27H41F2NO4/c1-4-6-7-8-9-10-11-12-20-13-14-21(24(29)23(20)28)19-30(3)22-15-17-27(18-16-22,25(31)32)26(33)34-5-2/h13-14,22H,4-12,15-19H2,1-3H3,(H,31,32) |
| InChIKey | SJEWFFQDSFJGPN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|