C24H36F2N2O3 — CID 68991887
3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid (PubChem CID 68991887) has the molecular formula C24H36F2N2O3 and a molecular weight of 438.56 g/mol. Its IUPAC name is 3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid.
| Compound Name | 3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 68991887 |
| Molecular Formula | C24H36F2N2O3 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid |
| SMILES | CCCCCCCCCc1ccc(CNC2CCC(C(=O)O)(C(=O)NC)C2)c(F)c1F |
| InChI | InChI=1S/C24H36F2N2O3/c1-3-4-5-6-7-8-9-10-17-11-12-18(21(26)20(17)25)16-28-19-13-14-24(15-19,23(30)31)22(29)27-2/h11-12,19,28H,3-10,13-16H2,1-2H3,(H,27,29)(H,30,31) |
| InChIKey | OTFHAFRJBUWXLS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|