About 3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid
3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid (PubChem CID 68991887) has the molecular formula C24H36F2N2O3
and a molecular weight of 438.56 g/mol. Its IUPAC name is 3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid.
Molecular Properties
| Compound Name | 3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid |
| PubChem CID | 68991887 |
| Molecular Formula | C24H36F2N2O3 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | 3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid |
| SMILES | CCCCCCCCCc1ccc(CNC2CCC(C(=O)O)(C(=O)NC)C2)c(F)c1F |
| InChI | InChI=1S/C24H36F2N2O3/c1-3-4-5-6-7-8-9-10-17-11-12-18(21(26)20(17)25)16-28-19-13-14-24(15-19,23(30)31)22(29)27-2/h11-12,19,28H,3-10,13-16H2,1-2H3,(H,27,29)(H,30,31) |
| InChIKey | OTFHAFRJBUWXLS-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid?
The IUPAC name of 3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid (CID 68991887) is 3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid.
What is the SMILES notation for 3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid?
The canonical SMILES for 3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid is CCCCCCCCCc1ccc(CNC2CCC(C(=O)O)(C(=O)NC)C2)c(F)c1F.
What is the InChIKey of 3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid?
The InChIKey is OTFHAFRJBUWXLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H36F2N2O3/c1-3-4-5-6-7-8-9-10-17-11-12-18(21(26)20(17)25)16-28-19-13-14-24(15-19,23(30)31)22(29)27-2/h11-12,19,28H,3-10,13-16H2,1-2H3,(H,27,29)(H,30,31).
What are the key properties of 3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid?
3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid has a molecular weight of 438.56 g/mol, XLogP of 4.72, 13 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2,3-difluoro-4-nonylphenyl)methylamino]-1-(methylcarbamoyl)cyclopentane-1-carboxylic acid is sourced from PubChem (CID 68991887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).