About 3-[(3-chloro-4-nonoxyphenyl)methylamino]cyclopentane-1,1-dicarboxylic acid
3-[(3-chloro-4-nonoxyphenyl)methylamino]cyclopentane-1,1-dicarboxylic acid (PubChem CID 11583006) has the molecular formula C23H34ClNO5
and a molecular weight of 439.98 g/mol. Its IUPAC name is 3-[(3-chloro-4-nonoxyphenyl)methylamino]cyclopentane-1,1-dicarboxylic acid.
Molecular Properties
| Compound Name | 3-[(3-chloro-4-nonoxyphenyl)methylamino]cyclopentane-1,1-dicarboxylic acid |
| PubChem CID | 11583006 |
| Molecular Formula | C23H34ClNO5 |
| Molecular Weight | 439.98 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | 3-[(3-chloro-4-nonoxyphenyl)methylamino]cyclopentane-1,1-dicarboxylic acid |
| SMILES | CCCCCCCCCOc1ccc(CNC2CCC(C(=O)O)(C(=O)O)C2)cc1Cl |
| InChI | InChI=1S/C23H34ClNO5/c1-2-3-4-5-6-7-8-13-30-20-10-9-17(14-19(20)24)16-25-18-11-12-23(15-18,21(26)27)22(28)29/h9-10,14,18,25H,2-8,11-13,15-16H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | BNPUACXODXDNTR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 439.98 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3-[(3-chloro-4-nonoxyphenyl)methylamino]cyclopentane-1,1-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-chloro-4-nonoxyphenyl)methylamino]cyclopentane-1,1-dicarboxylic acid?
The IUPAC name of 3-[(3-chloro-4-nonoxyphenyl)methylamino]cyclopentane-1,1-dicarboxylic acid (CID 11583006) is 3-[(3-chloro-4-nonoxyphenyl)methylamino]cyclopentane-1,1-dicarboxylic acid.
What is the SMILES notation for 3-[(3-chloro-4-nonoxyphenyl)methylamino]cyclopentane-1,1-dicarboxylic acid?
The canonical SMILES for 3-[(3-chloro-4-nonoxyphenyl)methylamino]cyclopentane-1,1-dicarboxylic acid is CCCCCCCCCOc1ccc(CNC2CCC(C(=O)O)(C(=O)O)C2)cc1Cl.
What is the InChIKey of 3-[(3-chloro-4-nonoxyphenyl)methylamino]cyclopentane-1,1-dicarboxylic acid?
The InChIKey is BNPUACXODXDNTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H34ClNO5/c1-2-3-4-5-6-7-8-13-30-20-10-9-17(14-19(20)24)16-25-18-11-12-23(15-18,21(26)27)22(28)29/h9-10,14,18,25H,2-8,11-13,15-16H2,1H3,(H,26,27)(H,28,29).
What are the key properties of 3-[(3-chloro-4-nonoxyphenyl)methylamino]cyclopentane-1,1-dicarboxylic acid?
3-[(3-chloro-4-nonoxyphenyl)methylamino]cyclopentane-1,1-dicarboxylic acid has a molecular weight of 439.98 g/mol, XLogP of 5.27, 14 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-chloro-4-nonoxyphenyl)methylamino]cyclopentane-1,1-dicarboxylic acid is sourced from PubChem (CID 11583006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).