C25H36ClNO5 — CID 142778787
2-[5-[(3-chloro-4-decoxyphenyl)methylamino]pent-3-ynyl]propanedioic acid (PubChem CID 142778787) has the molecular formula C25H36ClNO5 and a molecular weight of 466.02 g/mol. Its IUPAC name is 2-[5-[(3-chloro-4-decoxyphenyl)methylamino]pent-3-ynyl]propanedioic acid.
| Compound Name | 2-[5-[(3-chloro-4-decoxyphenyl)methylamino]pent-3-ynyl]propanedioic acid |
|---|---|
| PubChem CID | 142778787 |
| Molecular Formula | C25H36ClNO5 |
| Molecular Weight | 466.02 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | 2-[5-[(3-chloro-4-decoxyphenyl)methylamino]pent-3-ynyl]propanedioic acid |
| SMILES | CCCCCCCCCCOc1ccc(CNCC#CCCC(C(=O)O)C(=O)O)cc1Cl |
| InChI | InChI=1S/C25H36ClNO5/c1-2-3-4-5-6-7-8-12-17-32-23-15-14-20(18-22(23)26)19-27-16-11-9-10-13-21(24(28)29)25(30)31/h14-15,18,21,27H,2-8,10,12-13,16-17,19H2,1H3,(H,28,29)(H,30,31) |
| InChIKey | VLFRVEJMFWZLNH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.02 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|