C18H23ClN2O — CID 169384780
1-[(3-chloro-4-pentoxyphenyl)methyl]-2-phenylhydrazine (PubChem CID 169384780) has the molecular formula C18H23ClN2O and a molecular weight of 318.85 g/mol. Its IUPAC name is 1-[(3-chloro-4-pentoxyphenyl)methyl]-2-phenylhydrazine.
| Compound Name | 1-[(3-chloro-4-pentoxyphenyl)methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169384780 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 1-[(3-chloro-4-pentoxyphenyl)methyl]-2-phenylhydrazine |
| SMILES | CCCCCOc1ccc(CNNc2ccccc2)cc1Cl |
| InChI | InChI=1S/C18H23ClN2O/c1-2-3-7-12-22-18-11-10-15(13-17(18)19)14-20-21-16-8-5-4-6-9-16/h4-6,8-11,13,20-21H,2-3,7,12,14H2,1H3 |
| InChIKey | ALZCNABGVONMGC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|