C19H25FN2O — CID 169384787
1-[(4-fluoro-3-hexoxyphenyl)methyl]-2-phenylhydrazine (PubChem CID 169384787) has the molecular formula C19H25FN2O and a molecular weight of 316.42 g/mol. Its IUPAC name is 1-[(4-fluoro-3-hexoxyphenyl)methyl]-2-phenylhydrazine.
| Compound Name | 1-[(4-fluoro-3-hexoxyphenyl)methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169384787 |
| Molecular Formula | C19H25FN2O |
| Molecular Weight | 316.42 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 1-[(4-fluoro-3-hexoxyphenyl)methyl]-2-phenylhydrazine |
| SMILES | CCCCCCOc1cc(CNNc2ccccc2)ccc1F |
| InChI | InChI=1S/C19H25FN2O/c1-2-3-4-8-13-23-19-14-16(11-12-18(19)20)15-21-22-17-9-6-5-7-10-17/h5-7,9-12,14,21-22H,2-4,8,13,15H2,1H3 |
| InChIKey | KLYOZEADHIWKSE-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|