C17H20F2N2O — CID 169385920
1-[(4-butoxy-2,6-difluorophenyl)methyl]-2-phenylhydrazine (PubChem CID 169385920) has the molecular formula C17H20F2N2O and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-[(4-butoxy-2,6-difluorophenyl)methyl]-2-phenylhydrazine.
| Compound Name | 1-[(4-butoxy-2,6-difluorophenyl)methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169385920 |
| Molecular Formula | C17H20F2N2O |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 1-[(4-butoxy-2,6-difluorophenyl)methyl]-2-phenylhydrazine |
| SMILES | CCCCOc1cc(F)c(CNNc2ccccc2)c(F)c1 |
| InChI | InChI=1S/C17H20F2N2O/c1-2-3-9-22-14-10-16(18)15(17(19)11-14)12-20-21-13-7-5-4-6-8-13/h4-8,10-11,20-21H,2-3,9,12H2,1H3 |
| InChIKey | DBFJLDWJZMATBJ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|