C16H18F2N2O — CID 169384890
1-[(3,5-difluoro-4-propoxyphenyl)methyl]-2-phenylhydrazine (PubChem CID 169384890) has the molecular formula C16H18F2N2O and a molecular weight of 292.33 g/mol. Its IUPAC name is 1-[(3,5-difluoro-4-propoxyphenyl)methyl]-2-phenylhydrazine.
| Compound Name | 1-[(3,5-difluoro-4-propoxyphenyl)methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169384890 |
| Molecular Formula | C16H18F2N2O |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 1-[(3,5-difluoro-4-propoxyphenyl)methyl]-2-phenylhydrazine |
| SMILES | CCCOc1c(F)cc(CNNc2ccccc2)cc1F |
| InChI | InChI=1S/C16H18F2N2O/c1-2-8-21-16-14(17)9-12(10-15(16)18)11-19-20-13-6-4-3-5-7-13/h3-7,9-10,19-20H,2,8,11H2,1H3 |
| InChIKey | NCQONNDMEUYZEH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|