C18H24N2O2 — CID 169386185
1-[[3-(methoxymethyl)-4-propoxyphenyl]methyl]-2-phenylhydrazine (PubChem CID 169386185) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 1-[[3-(methoxymethyl)-4-propoxyphenyl]methyl]-2-phenylhydrazine.
| Compound Name | 1-[[3-(methoxymethyl)-4-propoxyphenyl]methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169386185 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | 1-[[3-(methoxymethyl)-4-propoxyphenyl]methyl]-2-phenylhydrazine |
| SMILES | CCCOc1ccc(CNNc2ccccc2)cc1COC |
| InChI | InChI=1S/C18H24N2O2/c1-3-11-22-18-10-9-15(12-16(18)14-21-2)13-19-20-17-7-5-4-6-8-17/h4-10,12,19-20H,3,11,13-14H2,1-2H3 |
| InChIKey | KKPUPXJCSIASJE-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|