C21H20Cl2N2O2 — CID 169386081
1-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-phenylhydrazine (PubChem CID 169386081) has the molecular formula C21H20Cl2N2O2 and a molecular weight of 403.31 g/mol. Its IUPAC name is 1-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-phenylhydrazine.
| Compound Name | 1-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169386081 |
| Molecular Formula | C21H20Cl2N2O2 |
| Molecular Weight | 403.31 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | 1-[[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methyl]-2-phenylhydrazine |
| SMILES | COc1cc(CNNc2ccccc2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H20Cl2N2O2/c1-26-21-11-15(13-24-25-18-5-3-2-4-6-18)7-10-20(21)27-14-16-8-9-17(22)12-19(16)23/h2-12,24-25H,13-14H2,1H3 |
| InChIKey | QNLSDLKNIONKFU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.31 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|