C21H19Cl3N2O2 — CID 169385117
1-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methyl]-2-phenylhydrazine (PubChem CID 169385117) has the molecular formula C21H19Cl3N2O2 and a molecular weight of 437.75 g/mol. Its IUPAC name is 1-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methyl]-2-phenylhydrazine.
| Compound Name | 1-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169385117 |
| Molecular Formula | C21H19Cl3N2O2 |
| Molecular Weight | 437.75 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 1-[[4-methoxy-3-[(2,4,6-trichlorophenoxy)methyl]phenyl]methyl]-2-phenylhydrazine |
| SMILES | COc1ccc(CNNc2ccccc2)cc1COc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C21H19Cl3N2O2/c1-27-20-8-7-14(12-25-26-17-5-3-2-4-6-17)9-15(20)13-28-21-18(23)10-16(22)11-19(21)24/h2-11,25-26H,12-13H2,1H3 |
| InChIKey | RILYWKXCPHPESC-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.75 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|