C15H16F2N2O2 — CID 169384519
1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-phenylhydrazine (PubChem CID 169384519) has the molecular formula C15H16F2N2O2 and a molecular weight of 294.30 g/mol. Its IUPAC name is 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-phenylhydrazine.
| Compound Name | 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-phenylhydrazine |
|---|---|
| PubChem CID | 169384519 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | 1-[[4-(difluoromethoxy)-3-methoxyphenyl]methyl]-2-phenylhydrazine |
| SMILES | COc1cc(CNNc2ccccc2)ccc1OC(F)F |
| InChI | InChI=1S/C15H16F2N2O2/c1-20-14-9-11(7-8-13(14)21-15(16)17)10-18-19-12-5-3-2-4-6-12/h2-9,15,18-19H,10H2,1H3 |
| InChIKey | PIGOIFYUFHMHRQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|