C21H18Cl2N2O2 — CID 110338414
N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]aniline (PubChem CID 110338414) has the molecular formula C21H18Cl2N2O2 and a molecular weight of 401.29 g/mol. Its IUPAC name is N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]aniline.
| Compound Name | N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]aniline |
|---|---|
| PubChem CID | 110338414 |
| Molecular Formula | C21H18Cl2N2O2 |
| Molecular Weight | 401.29 g/mol |
| Exact Mass | 400.07 |
| IUPAC Name | N-[(E)-[4-[(2,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylideneamino]aniline |
| SMILES | COc1cc(/C=N/Nc2ccccc2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H18Cl2N2O2/c1-26-21-11-15(13-24-25-18-5-3-2-4-6-18)7-10-20(21)27-14-16-8-9-17(22)12-19(16)23/h2-13,25H,14H2,1H3/b24-13+ |
| InChIKey | INYCBVXJGDREMP-ZMOGYAJESA-N |
| XLogP | 6.03 |
| TPSA | 42.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.29 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|