C26H37F2NO6 — CID 68992596
3-[2-(4-decyl-2,3-difluorophenyl)ethoxycarbonylamino]cyclopentane-1,1-dicarboxylic acid (PubChem CID 68992596) has the molecular formula C26H37F2NO6 and a molecular weight of 497.58 g/mol. Its IUPAC name is 3-[2-(4-decyl-2,3-difluorophenyl)ethoxycarbonylamino]cyclopentane-1,1-dicarboxylic acid.
| Compound Name | 3-[2-(4-decyl-2,3-difluorophenyl)ethoxycarbonylamino]cyclopentane-1,1-dicarboxylic acid |
|---|---|
| PubChem CID | 68992596 |
| Molecular Formula | C26H37F2NO6 |
| Molecular Weight | 497.58 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 3-[2-(4-decyl-2,3-difluorophenyl)ethoxycarbonylamino]cyclopentane-1,1-dicarboxylic acid |
| SMILES | CCCCCCCCCCc1ccc(CCOC(=O)NC2CCC(C(=O)O)(C(=O)O)C2)c(F)c1F |
| InChI | InChI=1S/C26H37F2NO6/c1-2-3-4-5-6-7-8-9-10-18-11-12-19(22(28)21(18)27)14-16-35-25(34)29-20-13-15-26(17-20,23(30)31)24(32)33/h11-12,20H,2-10,13-17H2,1H3,(H,29,34)(H,30,31)(H,32,33) |
| InChIKey | RAPWMBRYLFGHQP-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.58 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|