C28H31FO — CID 142331671
1-[3-fluoro-4-[4-(4-pentylphenyl)phenyl]phenyl]-2,2-dimethylpropan-1-one (PubChem CID 142331671) has the molecular formula C28H31FO and a molecular weight of 402.55 g/mol. Its IUPAC name is 1-[3-fluoro-4-[4-(4-pentylphenyl)phenyl]phenyl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[3-fluoro-4-[4-(4-pentylphenyl)phenyl]phenyl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 142331671 |
| Molecular Formula | C28H31FO |
| Molecular Weight | 402.55 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 1-[3-fluoro-4-[4-(4-pentylphenyl)phenyl]phenyl]-2,2-dimethylpropan-1-one |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(C(=O)C(C)(C)C)cc3F)cc2)cc1 |
| InChI | InChI=1S/C28H31FO/c1-5-6-7-8-20-9-11-21(12-10-20)22-13-15-23(16-14-22)25-18-17-24(19-26(25)29)27(30)28(2,3)4/h9-19H,5-8H2,1-4H3 |
| InChIKey | IQYSQGGFOPBUCA-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.55 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|