C28H34O2 — CID 163793056
2-[4-[2-ethyl-4-(4-hexylphenyl)phenyl]phenoxy]ethanol (PubChem CID 163793056) has the molecular formula C28H34O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is 2-[4-[2-ethyl-4-(4-hexylphenyl)phenyl]phenoxy]ethanol.
| Compound Name | 2-[4-[2-ethyl-4-(4-hexylphenyl)phenyl]phenoxy]ethanol |
|---|---|
| PubChem CID | 163793056 |
| Molecular Formula | C28H34O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | 2-[4-[2-ethyl-4-(4-hexylphenyl)phenyl]phenoxy]ethanol |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3ccc(OCCO)cc3)c(CC)c2)cc1 |
| InChI | InChI=1S/C28H34O2/c1-3-5-6-7-8-22-9-11-24(12-10-22)26-15-18-28(23(4-2)21-26)25-13-16-27(17-14-25)30-20-19-29/h9-18,21,29H,3-8,19-20H2,1-2H3 |
| InChIKey | MYMIRSJEWWFFBM-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|