C33H36O — CID 139457480
3-ethyl-4-[4-[2-ethyl-4-(4-pentylphenyl)phenyl]phenyl]phenol (PubChem CID 139457480) has the molecular formula C33H36O and a molecular weight of 448.65 g/mol. Its IUPAC name is 3-ethyl-4-[4-[2-ethyl-4-(4-pentylphenyl)phenyl]phenyl]phenol.
| Compound Name | 3-ethyl-4-[4-[2-ethyl-4-(4-pentylphenyl)phenyl]phenyl]phenol |
|---|---|
| PubChem CID | 139457480 |
| Molecular Formula | C33H36O |
| Molecular Weight | 448.65 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | 3-ethyl-4-[4-[2-ethyl-4-(4-pentylphenyl)phenyl]phenyl]phenol |
| SMILES | CCCCCc1ccc(-c2ccc(-c3ccc(-c4ccc(O)cc4CC)cc3)c(CC)c2)cc1 |
| InChI | InChI=1S/C33H36O/c1-4-7-8-9-24-10-12-27(13-11-24)30-18-20-32(25(5-2)22-30)28-14-16-29(17-15-28)33-21-19-31(34)23-26(33)6-3/h10-23,34H,4-9H2,1-3H3 |
| InChIKey | VWVKOIHZWMINSR-UHFFFAOYSA-N |
| XLogP | 9.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.65 |
| LogP ≤ 5 | 9.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|