C24H26 — CID 157074789
2-ethyl-1,4-bis(4-ethylphenyl)benzene (PubChem CID 157074789) has the molecular formula C24H26 and a molecular weight of 314.47 g/mol. Its IUPAC name is 2-ethyl-1,4-bis(4-ethylphenyl)benzene.
| Compound Name | 2-ethyl-1,4-bis(4-ethylphenyl)benzene |
|---|---|
| PubChem CID | 157074789 |
| Molecular Formula | C24H26 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 2-ethyl-1,4-bis(4-ethylphenyl)benzene |
| SMILES | CCc1ccc(-c2ccc(-c3ccc(CC)cc3)c(CC)c2)cc1 |
| InChI | InChI=1S/C24H26/c1-4-18-7-11-21(12-8-18)23-15-16-24(20(6-3)17-23)22-13-9-19(5-2)10-14-22/h7-17H,4-6H2,1-3H3 |
| InChIKey | XNWYCGAPFAZJSF-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |