C29H22O3 — CID 121306788
3-(4-ethylphenyl)-6-[4-(hydroxymethyl)phenyl]phenanthrene-9,10-dione (PubChem CID 121306788) has the molecular formula C29H22O3 and a molecular weight of 418.49 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-6-[4-(hydroxymethyl)phenyl]phenanthrene-9,10-dione.
| Compound Name | 3-(4-ethylphenyl)-6-[4-(hydroxymethyl)phenyl]phenanthrene-9,10-dione |
|---|---|
| PubChem CID | 121306788 |
| Molecular Formula | C29H22O3 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | 3-(4-ethylphenyl)-6-[4-(hydroxymethyl)phenyl]phenanthrene-9,10-dione |
| SMILES | CCc1ccc(-c2ccc3c(c2)-c2cc(-c4ccc(CO)cc4)ccc2C(=O)C3=O)cc1 |
| InChI | InChI=1S/C29H22O3/c1-2-18-3-7-20(8-4-18)22-11-13-24-26(15-22)27-16-23(12-14-25(27)29(32)28(24)31)21-9-5-19(17-30)6-10-21/h3-16,30H,2,17H2,1H3 |
| InChIKey | RVFMVKJAWQVMRN-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|