About (4-ethylphenyl)methanol;formamide
(4-ethylphenyl)methanol;formamide (PubChem CID 142287021) has the molecular formula C10H15NO2
and a molecular weight of 181.23 g/mol. Its IUPAC name is (4-ethylphenyl)methanol;formamide.
Molecular Properties
| Compound Name | (4-ethylphenyl)methanol;formamide |
| PubChem CID | 142287021 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (4-ethylphenyl)methanol;formamide |
| SMILES | CCc1ccc(CO)cc1.NC=O |
| InChI | InChI=1S/C9H12O.CH3NO/c1-2-8-3-5-9(7-10)6-4-8;2-1-3/h3-6,10H,2,7H2,1H3;1H,(H2,2,3) |
| InChIKey | OPAIHBYYBNDKKY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4-ethylphenyl)methanol;formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylphenyl)methanol;formamide?
The IUPAC name of (4-ethylphenyl)methanol;formamide (CID 142287021) is (4-ethylphenyl)methanol;formamide.
What is the SMILES notation for (4-ethylphenyl)methanol;formamide?
The canonical SMILES for (4-ethylphenyl)methanol;formamide is CCc1ccc(CO)cc1.NC=O.
What is the InChIKey of (4-ethylphenyl)methanol;formamide?
The InChIKey is OPAIHBYYBNDKKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O.CH3NO/c1-2-8-3-5-9(7-10)6-4-8;2-1-3/h3-6,10H,2,7H2,1H3;1H,(H2,2,3).
What are the key properties of (4-ethylphenyl)methanol;formamide?
(4-ethylphenyl)methanol;formamide has a molecular weight of 181.23 g/mol, XLogP of 0.84, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylphenyl)methanol;formamide is sourced from PubChem (CID 142287021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).