C12H20 — CID 91207141
1,4-diethylbenzene;ethane (PubChem CID 91207141) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is 1,4-diethylbenzene;ethane.
| Compound Name | 1,4-diethylbenzene;ethane |
|---|---|
| PubChem CID | 91207141 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 1,4-diethylbenzene;ethane |
| SMILES | CC.CCc1ccc(CC)cc1 |
| InChI | InChI=1S/C10H14.C2H6/c1-3-9-5-7-10(4-2)8-6-9;1-2/h5-8H,3-4H2,1-2H3;1-2H3 |
| InChIKey | LRQRQCDPXAASRJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |