About ethane;1-ethyl-4-methylbenzene;fluoromethane
ethane;1-ethyl-4-methylbenzene;fluoromethane (PubChem CID 142146910) has the molecular formula C12H21F
and a molecular weight of 184.30 g/mol. Its IUPAC name is ethane;1-ethyl-4-methylbenzene;fluoromethane.
Molecular Properties
| Compound Name | ethane;1-ethyl-4-methylbenzene;fluoromethane |
| PubChem CID | 142146910 |
| Molecular Formula | C12H21F |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | ethane;1-ethyl-4-methylbenzene;fluoromethane |
| SMILES | CC.CCc1ccc(C)cc1.CF |
| InChI | InChI=1S/C9H12.C2H6.CH3F/c1-3-9-6-4-8(2)5-7-9;2*1-2/h4-7H,3H2,1-2H3;1-2H3;1H3 |
| InChIKey | OLFDZRJZSPZLCX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-ethyl-4-methylbenzene;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-4-methylbenzene;fluoromethane?
The IUPAC name of ethane;1-ethyl-4-methylbenzene;fluoromethane (CID 142146910) is ethane;1-ethyl-4-methylbenzene;fluoromethane.
What is the SMILES notation for ethane;1-ethyl-4-methylbenzene;fluoromethane?
The canonical SMILES for ethane;1-ethyl-4-methylbenzene;fluoromethane is CC.CCc1ccc(C)cc1.CF.
What is the InChIKey of ethane;1-ethyl-4-methylbenzene;fluoromethane?
The InChIKey is OLFDZRJZSPZLCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C2H6.CH3F/c1-3-9-6-4-8(2)5-7-9;2*1-2/h4-7H,3H2,1-2H3;1-2H3;1H3.
What are the key properties of ethane;1-ethyl-4-methylbenzene;fluoromethane?
ethane;1-ethyl-4-methylbenzene;fluoromethane has a molecular weight of 184.30 g/mol, XLogP of 4.17, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-4-methylbenzene;fluoromethane is sourced from PubChem (CID 142146910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).