About ethane;1-ethyl-4-methylbenzene;prop-1-ene
ethane;1-ethyl-4-methylbenzene;prop-1-ene (PubChem CID 143347591) has the molecular formula C14H24
and a molecular weight of 192.35 g/mol. Its IUPAC name is ethane;1-ethyl-4-methylbenzene;prop-1-ene.
Molecular Properties
| Compound Name | ethane;1-ethyl-4-methylbenzene;prop-1-ene |
| PubChem CID | 143347591 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | ethane;1-ethyl-4-methylbenzene;prop-1-ene |
| SMILES | C=CC.CC.CCc1ccc(C)cc1 |
| InChI | InChI=1S/C9H12.C3H6.C2H6/c1-3-9-6-4-8(2)5-7-9;1-3-2;1-2/h4-7H,3H2,1-2H3;3H,1H2,2H3;1-2H3 |
| InChIKey | SWWNQFUGKPSFMS-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethyl-4-methylbenzene;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-4-methylbenzene;prop-1-ene?
The IUPAC name of ethane;1-ethyl-4-methylbenzene;prop-1-ene (CID 143347591) is ethane;1-ethyl-4-methylbenzene;prop-1-ene.
What is the SMILES notation for ethane;1-ethyl-4-methylbenzene;prop-1-ene?
The canonical SMILES for ethane;1-ethyl-4-methylbenzene;prop-1-ene is C=CC.CC.CCc1ccc(C)cc1.
What is the InChIKey of ethane;1-ethyl-4-methylbenzene;prop-1-ene?
The InChIKey is SWWNQFUGKPSFMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C3H6.C2H6/c1-3-9-6-4-8(2)5-7-9;1-3-2;1-2/h4-7H,3H2,1-2H3;3H,1H2,2H3;1-2H3.
What are the key properties of ethane;1-ethyl-4-methylbenzene;prop-1-ene?
ethane;1-ethyl-4-methylbenzene;prop-1-ene has a molecular weight of 192.35 g/mol, XLogP of 4.78, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-4-methylbenzene;prop-1-ene is sourced from PubChem (CID 143347591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).