About ethylbenzene;1-ethyl-4-methylbenzene;propane
ethylbenzene;1-ethyl-4-methylbenzene;propane (PubChem CID 160625021) has the molecular formula C20H30
and a molecular weight of 270.46 g/mol. Its IUPAC name is ethylbenzene;1-ethyl-4-methylbenzene;propane.
Molecular Properties
| Compound Name | ethylbenzene;1-ethyl-4-methylbenzene;propane |
| PubChem CID | 160625021 |
| Molecular Formula | C20H30 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.23 |
| IUPAC Name | ethylbenzene;1-ethyl-4-methylbenzene;propane |
| SMILES | CCC.CCc1ccc(C)cc1.CCc1ccccc1 |
| InChI | InChI=1S/C9H12.C8H10.C3H8/c1-3-9-6-4-8(2)5-7-9;1-2-8-6-4-3-5-7-8;1-3-2/h4-7H,3H2,1-2H3;3-7H,2H2,1H3;3H2,1-2H3 |
| InChIKey | RHEMPIJACKRRBY-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethylbenzene;1-ethyl-4-methylbenzene;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylbenzene;1-ethyl-4-methylbenzene;propane?
The IUPAC name of ethylbenzene;1-ethyl-4-methylbenzene;propane (CID 160625021) is ethylbenzene;1-ethyl-4-methylbenzene;propane.
What is the SMILES notation for ethylbenzene;1-ethyl-4-methylbenzene;propane?
The canonical SMILES for ethylbenzene;1-ethyl-4-methylbenzene;propane is CCC.CCc1ccc(C)cc1.CCc1ccccc1.
What is the InChIKey of ethylbenzene;1-ethyl-4-methylbenzene;propane?
The InChIKey is RHEMPIJACKRRBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12.C8H10.C3H8/c1-3-9-6-4-8(2)5-7-9;1-2-8-6-4-3-5-7-8;1-3-2/h4-7H,3H2,1-2H3;3-7H,2H2,1H3;3H2,1-2H3.
What are the key properties of ethylbenzene;1-ethyl-4-methylbenzene;propane?
ethylbenzene;1-ethyl-4-methylbenzene;propane has a molecular weight of 270.46 g/mol, XLogP of 6.22, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethylbenzene;1-ethyl-4-methylbenzene;propane is sourced from PubChem (CID 160625021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).