C13H16 — CID 123858491
1-ethyl-4-methylcyclodeca-1,3,5,7,9-pentaene (PubChem CID 123858491) has the molecular formula C13H16 and a molecular weight of 172.27 g/mol. Its IUPAC name is 1-ethyl-4-methylcyclodeca-1,3,5,7,9-pentaene.
| Compound Name | 1-ethyl-4-methylcyclodeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 123858491 |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | 1-ethyl-4-methylcyclodeca-1,3,5,7,9-pentaene |
| SMILES | CCc1ccccccc(C)cc1 |
| InChI | InChI=1S/C13H16/c1-3-13-9-7-5-4-6-8-12(2)10-11-13/h4-11H,3H2,1-2H3/b5-4+,6-4+,7-5-,8-6-,9-7-,11-10+,12-8-,12-10-,13-9-,13-11+ |
| InChIKey | BZCKTDVTOQFZCV-OSZOLHJASA-N |
| XLogP | 3.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |