C18H22 — CID 91350329
8-ethyl-1,3-dimethylcyclotetradeca-1,3,5,7,9,11,13-heptaene (PubChem CID 91350329) has the molecular formula C18H22 and a molecular weight of 238.37 g/mol. Its IUPAC name is 8-ethyl-1,3-dimethylcyclotetradeca-1,3,5,7,9,11,13-heptaene.
| Compound Name | 8-ethyl-1,3-dimethylcyclotetradeca-1,3,5,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 91350329 |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 8-ethyl-1,3-dimethylcyclotetradeca-1,3,5,7,9,11,13-heptaene |
| SMILES | CCc1ccccccc(C)cc(C)cccc1 |
| InChI | InChI=1S/C18H22/c1-4-18-13-8-6-5-7-11-16(2)15-17(3)12-9-10-14-18/h5-15H,4H2,1-3H3/b6-5+,7-5-,8-6+,10-9-,11-7+,12-9+,13-8-,14-10+,16-11+,16-15-,17-12+,17-15-,18-13-,18-14+ |
| InChIKey | OQKCAKLHAANKSZ-UWOSHPGUSA-N |
| XLogP | 5.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.37 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |