About 1-tert-butyl-4-ethylbenzene;prop-1-ene;toluene
1-tert-butyl-4-ethylbenzene;prop-1-ene;toluene (PubChem CID 171509592) has the molecular formula C22H32
and a molecular weight of 296.50 g/mol. Its IUPAC name is 1-tert-butyl-4-ethylbenzene;prop-1-ene;toluene.
Molecular Properties
| Compound Name | 1-tert-butyl-4-ethylbenzene;prop-1-ene;toluene |
| PubChem CID | 171509592 |
| Molecular Formula | C22H32 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.25 |
| IUPAC Name | 1-tert-butyl-4-ethylbenzene;prop-1-ene;toluene |
| SMILES | C=CC.CCc1ccc(C(C)(C)C)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C12H18.C7H8.C3H6/c1-5-10-6-8-11(9-7-10)12(2,3)4;1-7-5-3-2-4-6-7;1-3-2/h6-9H,5H2,1-4H3;2-6H,1H3;3H,1H2,2H3 |
| InChIKey | YAMUJQBLYYBZBX-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-tert-butyl-4-ethylbenzene;prop-1-ene;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-4-ethylbenzene;prop-1-ene;toluene?
The IUPAC name of 1-tert-butyl-4-ethylbenzene;prop-1-ene;toluene (CID 171509592) is 1-tert-butyl-4-ethylbenzene;prop-1-ene;toluene.
What is the SMILES notation for 1-tert-butyl-4-ethylbenzene;prop-1-ene;toluene?
The canonical SMILES for 1-tert-butyl-4-ethylbenzene;prop-1-ene;toluene is C=CC.CCc1ccc(C(C)(C)C)cc1.Cc1ccccc1.
What is the InChIKey of 1-tert-butyl-4-ethylbenzene;prop-1-ene;toluene?
The InChIKey is YAMUJQBLYYBZBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C7H8.C3H6/c1-5-10-6-8-11(9-7-10)12(2,3)4;1-7-5-3-2-4-6-7;1-3-2/h6-9H,5H2,1-4H3;2-6H,1H3;3H,1H2,2H3.
What are the key properties of 1-tert-butyl-4-ethylbenzene;prop-1-ene;toluene?
1-tert-butyl-4-ethylbenzene;prop-1-ene;toluene has a molecular weight of 296.50 g/mol, XLogP of 6.73, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-4-ethylbenzene;prop-1-ene;toluene is sourced from PubChem (CID 171509592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).