C24H28 — CID 142597809
1,1'-biphenyl;1-tert-butyl-4-ethylbenzene (PubChem CID 142597809) has the molecular formula C24H28 and a molecular weight of 316.49 g/mol. Its IUPAC name is 1,1'-biphenyl;1-tert-butyl-4-ethylbenzene.
| Compound Name | 1,1'-biphenyl;1-tert-butyl-4-ethylbenzene |
|---|---|
| PubChem CID | 142597809 |
| Molecular Formula | C24H28 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 1,1'-biphenyl;1-tert-butyl-4-ethylbenzene |
| SMILES | CCc1ccc(C(C)(C)C)cc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C12H18/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-5-10-6-8-11(9-7-10)12(2,3)4/h1-10H;6-9H,5H2,1-4H3 |
| InChIKey | AYCSREVWYVXCBZ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |