About acetylene;1-ethyl-4-phenylbenzene
acetylene;1-ethyl-4-phenylbenzene (PubChem CID 175126841) has the molecular formula C16H16
and a molecular weight of 208.30 g/mol. Its IUPAC name is acetylene;1-ethyl-4-phenylbenzene.
Molecular Properties
| Compound Name | acetylene;1-ethyl-4-phenylbenzene |
| PubChem CID | 175126841 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | acetylene;1-ethyl-4-phenylbenzene |
| SMILES | C#C.CCc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C14H14.C2H2/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13;1-2/h3-11H,2H2,1H3;1-2H |
| InChIKey | MFKIIOBDMAAXEG-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;1-ethyl-4-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;1-ethyl-4-phenylbenzene?
The IUPAC name of acetylene;1-ethyl-4-phenylbenzene (CID 175126841) is acetylene;1-ethyl-4-phenylbenzene.
What is the SMILES notation for acetylene;1-ethyl-4-phenylbenzene?
The canonical SMILES for acetylene;1-ethyl-4-phenylbenzene is C#C.CCc1ccc(-c2ccccc2)cc1.
What is the InChIKey of acetylene;1-ethyl-4-phenylbenzene?
The InChIKey is MFKIIOBDMAAXEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14.C2H2/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13;1-2/h3-11H,2H2,1H3;1-2H.
What are the key properties of acetylene;1-ethyl-4-phenylbenzene?
acetylene;1-ethyl-4-phenylbenzene has a molecular weight of 208.30 g/mol, XLogP of 4.17, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;1-ethyl-4-phenylbenzene is sourced from PubChem (CID 175126841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).