About 1,1'-biphenyl;ethylbenzene;naphthalene
1,1'-biphenyl;ethylbenzene;naphthalene (PubChem CID 163537509) has the molecular formula C30H28
and a molecular weight of 388.55 g/mol. Its IUPAC name is 1,1'-biphenyl;ethylbenzene;naphthalene.
Molecular Properties
| Compound Name | 1,1'-biphenyl;ethylbenzene;naphthalene |
| PubChem CID | 163537509 |
| Molecular Formula | C30H28 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | 1,1'-biphenyl;ethylbenzene;naphthalene |
| SMILES | CCc1ccccc1.c1ccc(-c2ccccc2)cc1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H10.C10H8.C8H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-6-10-8-4-3-7-9(10)5-1;1-2-8-6-4-3-5-7-8/h1-10H;1-8H;3-7H,2H2,1H3 |
| InChIKey | DYGLENLDUMQDHY-UHFFFAOYSA-N |
| XLogP | 8.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,1'-biphenyl;ethylbenzene;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1'-biphenyl;ethylbenzene;naphthalene?
The IUPAC name of 1,1'-biphenyl;ethylbenzene;naphthalene (CID 163537509) is 1,1'-biphenyl;ethylbenzene;naphthalene.
What is the SMILES notation for 1,1'-biphenyl;ethylbenzene;naphthalene?
The canonical SMILES for 1,1'-biphenyl;ethylbenzene;naphthalene is CCc1ccccc1.c1ccc(-c2ccccc2)cc1.c1ccc2ccccc2c1.
What is the InChIKey of 1,1'-biphenyl;ethylbenzene;naphthalene?
The InChIKey is DYGLENLDUMQDHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10.C10H8.C8H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-2-6-10-8-4-3-7-9(10)5-1;1-2-8-6-4-3-5-7-8/h1-10H;1-8H;3-7H,2H2,1H3.
What are the key properties of 1,1'-biphenyl;ethylbenzene;naphthalene?
1,1'-biphenyl;ethylbenzene;naphthalene has a molecular weight of 388.55 g/mol, XLogP of 8.44, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1'-biphenyl;ethylbenzene;naphthalene is sourced from PubChem (CID 163537509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).