C28H35N — CID 59863448
N,N-bis(4-tert-butylphenyl)-4-ethylaniline (PubChem CID 59863448) has the molecular formula C28H35N and a molecular weight of 385.60 g/mol. Its IUPAC name is N,N-bis(4-tert-butylphenyl)-4-ethylaniline.
| Compound Name | N,N-bis(4-tert-butylphenyl)-4-ethylaniline |
|---|---|
| PubChem CID | 59863448 |
| Molecular Formula | C28H35N |
| Molecular Weight | 385.60 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | N,N-bis(4-tert-butylphenyl)-4-ethylaniline |
| SMILES | CCc1ccc(N(c2ccc(C(C)(C)C)cc2)c2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C28H35N/c1-8-21-9-15-24(16-10-21)29(25-17-11-22(12-18-25)27(2,3)4)26-19-13-23(14-20-26)28(5,6)7/h9-20H,8H2,1-7H3 |
| InChIKey | WSSQEMMYPZEIQV-UHFFFAOYSA-N |
| XLogP | 8.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.60 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |