C54H59NS — CID 143481097
N,N-bis[4-[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]-4-[(E)-2-[4-[(trimethyl-λ4-sulfanyl)methyl]phenyl]ethenyl]aniline (PubChem CID 143481097) has the molecular formula C54H59NS and a molecular weight of 754.14 g/mol. Its IUPAC name is N,N-bis[4-[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]-4-[(E)-2-[4-[(trimethyl-λ4-sulfanyl)methyl]phenyl]ethenyl]aniline.
| Compound Name | N,N-bis[4-[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]-4-[(E)-2-[4-[(trimethyl-λ4-sulfanyl)methyl]phenyl]ethenyl]aniline |
|---|---|
| PubChem CID | 143481097 |
| Molecular Formula | C54H59NS |
| Molecular Weight | 754.14 g/mol |
| Exact Mass | 753.44 |
| IUPAC Name | N,N-bis[4-[(E)-2-(4-tert-butylphenyl)ethenyl]phenyl]-4-[(E)-2-[4-[(trimethyl-λ4-sulfanyl)methyl]phenyl]ethenyl]aniline |
| SMILES | CC(C)(C)c1ccc(/C=C/c2ccc(N(c3ccc(/C=C/c4ccc(CS(C)(C)C)cc4)cc3)c3ccc(/C=C/c4ccc(C(C)(C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C54H59NS/c1-53(2,3)48-30-20-42(21-31-48)11-14-45-26-36-51(37-27-45)55(52-38-28-46(29-39-52)15-12-43-22-32-49(33-23-43)54(4,5)6)50-34-24-44(25-35-50)13-10-41-16-18-47(19-17-41)40-56(7,8)9/h10-39H,40H2,1-9H3/b13-10+,14-11+,15-12+ |
| InChIKey | YLZVAESNMBZSON-DZURWXOBSA-N |
| XLogP | 15.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.14 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|