C30H34 — CID 102332044
1,4-bis[(Z)-2-(4-tert-butylphenyl)ethenyl]benzene (PubChem CID 102332044) has the molecular formula C30H34 and a molecular weight of 394.60 g/mol. Its IUPAC name is 1,4-bis[(Z)-2-(4-tert-butylphenyl)ethenyl]benzene.
| Compound Name | 1,4-bis[(Z)-2-(4-tert-butylphenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 102332044 |
| Molecular Formula | C30H34 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.27 |
| IUPAC Name | 1,4-bis[(Z)-2-(4-tert-butylphenyl)ethenyl]benzene |
| SMILES | CC(C)(C)c1ccc(/C=C\c2ccc(/C=C\c3ccc(C(C)(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C30H34/c1-29(2,3)27-19-15-25(16-20-27)13-11-23-7-9-24(10-8-23)12-14-26-17-21-28(22-18-26)30(4,5)6/h7-22H,1-6H3/b13-11-,14-12- |
| InChIKey | DHXABHPUQVFYIM-XSYHWHKQSA-N |
| XLogP | 8.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|