C20H24O2 — CID 102263178
1-[(E)-2-(4-tert-butylphenyl)ethenyl]-3,5-dimethoxybenzene (PubChem CID 102263178) has the molecular formula C20H24O2 and a molecular weight of 296.41 g/mol. Its IUPAC name is 1-[(E)-2-(4-tert-butylphenyl)ethenyl]-3,5-dimethoxybenzene.
| Compound Name | 1-[(E)-2-(4-tert-butylphenyl)ethenyl]-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 102263178 |
| Molecular Formula | C20H24O2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.18 |
| IUPAC Name | 1-[(E)-2-(4-tert-butylphenyl)ethenyl]-3,5-dimethoxybenzene |
| SMILES | COc1cc(/C=C/c2ccc(C(C)(C)C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C20H24O2/c1-20(2,3)17-10-8-15(9-11-17)6-7-16-12-18(21-4)14-19(13-16)22-5/h6-14H,1-5H3/b7-6+ |
| InChIKey | IDFIYQJCIUPDIT-VOTSOKGWSA-N |
| XLogP | 5.17 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|