C18H21NO2 — CID 85073346
4-[2-(3,5-dimethoxyphenyl)ethenyl]-N,N-dimethylaniline (PubChem CID 85073346) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 4-[2-(3,5-dimethoxyphenyl)ethenyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-(3,5-dimethoxyphenyl)ethenyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 85073346 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 4-[2-(3,5-dimethoxyphenyl)ethenyl]-N,N-dimethylaniline |
| SMILES | COc1cc(C=Cc2ccc(N(C)C)cc2)cc(OC)c1 |
| InChI | InChI=1S/C18H21NO2/c1-19(2)16-9-7-14(8-10-16)5-6-15-11-17(20-3)13-18(12-15)21-4/h5-13H,1-4H3 |
| InChIKey | ZUZKIIFEMDKRLO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|