C19H23NO3 — CID 54188943
N,N-dimethyl-4-[2-(3,4,5-trimethoxyphenyl)ethenyl]aniline (PubChem CID 54188943) has the molecular formula C19H23NO3 and a molecular weight of 313.40 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(3,4,5-trimethoxyphenyl)ethenyl]aniline.
| Compound Name | N,N-dimethyl-4-[2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
|---|---|
| PubChem CID | 54188943 |
| Molecular Formula | C19H23NO3 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | N,N-dimethyl-4-[2-(3,4,5-trimethoxyphenyl)ethenyl]aniline |
| SMILES | COc1cc(C=Cc2ccc(N(C)C)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H23NO3/c1-20(2)16-10-8-14(9-11-16)6-7-15-12-17(21-3)19(23-5)18(13-15)22-4/h6-13H,1-5H3 |
| InChIKey | PHDDAWSHQWUPPP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|