C25H19Br5O3 — CID 141245082
1,2,3,4,5-pentabromo-6-[2-[4-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]ethenyl]benzene (PubChem CID 141245082) has the molecular formula C25H19Br5O3 and a molecular weight of 766.94 g/mol. Its IUPAC name is 1,2,3,4,5-pentabromo-6-[2-[4-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]ethenyl]benzene.
| Compound Name | 1,2,3,4,5-pentabromo-6-[2-[4-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 141245082 |
| Molecular Formula | C25H19Br5O3 |
| Molecular Weight | 766.94 g/mol |
| Exact Mass | 761.73 |
| IUPAC Name | 1,2,3,4,5-pentabromo-6-[2-[4-[2-(3,4,5-trimethoxyphenyl)ethenyl]phenyl]ethenyl]benzene |
| SMILES | COc1cc(C=Cc2ccc(C=Cc3c(Br)c(Br)c(Br)c(Br)c3Br)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C25H19Br5O3/c1-31-18-12-16(13-19(32-2)25(18)33-3)9-8-14-4-6-15(7-5-14)10-11-17-20(26)22(28)24(30)23(29)21(17)27/h4-13H,1-3H3 |
| InChIKey | SKJJEVKZTXACDX-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.94 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|