C17H17NO5 — CID 14256048
1,2,3-trimethoxy-5-[(Z)-2-(4-nitrophenyl)ethenyl]benzene (PubChem CID 14256048) has the molecular formula C17H17NO5 and a molecular weight of 315.33 g/mol. Its IUPAC name is 1,2,3-trimethoxy-5-[(Z)-2-(4-nitrophenyl)ethenyl]benzene.
| Compound Name | 1,2,3-trimethoxy-5-[(Z)-2-(4-nitrophenyl)ethenyl]benzene |
|---|---|
| PubChem CID | 14256048 |
| Molecular Formula | C17H17NO5 |
| Molecular Weight | 315.33 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 1,2,3-trimethoxy-5-[(Z)-2-(4-nitrophenyl)ethenyl]benzene |
| SMILES | COc1cc(/C=C\c2ccc([N+](=O)[O-])cc2)cc(OC)c1OC |
| InChI | InChI=1S/C17H17NO5/c1-21-15-10-13(11-16(22-2)17(15)23-3)5-4-12-6-8-14(9-7-12)18(19)20/h4-11H,1-3H3/b5-4- |
| InChIKey | UDXWNMYENXAKPA-PLNGDYQASA-N |
| XLogP | 3.79 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.33 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|