C32H26N2O6 — CID 154194561
1,2-dimethoxy-4-[2-[3-[2-(2-nitrophenyl)ethenyl]-5-[2-(4-nitrophenyl)ethenyl]phenyl]ethenyl]benzene (PubChem CID 154194561) has the molecular formula C32H26N2O6 and a molecular weight of 534.57 g/mol. Its IUPAC name is 1,2-dimethoxy-4-[2-[3-[2-(2-nitrophenyl)ethenyl]-5-[2-(4-nitrophenyl)ethenyl]phenyl]ethenyl]benzene.
| Compound Name | 1,2-dimethoxy-4-[2-[3-[2-(2-nitrophenyl)ethenyl]-5-[2-(4-nitrophenyl)ethenyl]phenyl]ethenyl]benzene |
|---|---|
| PubChem CID | 154194561 |
| Molecular Formula | C32H26N2O6 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 1,2-dimethoxy-4-[2-[3-[2-(2-nitrophenyl)ethenyl]-5-[2-(4-nitrophenyl)ethenyl]phenyl]ethenyl]benzene |
| SMILES | COc1ccc(C=Cc2cc(C=Cc3ccc([N+](=O)[O-])cc3)cc(C=Cc3ccccc3[N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C32H26N2O6/c1-39-31-18-14-24(22-32(31)40-2)8-10-26-19-25(9-7-23-12-16-29(17-13-23)33(35)36)20-27(21-26)11-15-28-5-3-4-6-30(28)34(37)38/h3-22H,1-2H3 |
| InChIKey | JRVQXIQDSOIXJI-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|