C23H18N2O8 — CID 23962809
[4-[2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenyl] 2-methoxybenzoate (PubChem CID 23962809) has the molecular formula C23H18N2O8 and a molecular weight of 450.40 g/mol. Its IUPAC name is [4-[2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenyl] 2-methoxybenzoate.
| Compound Name | [4-[2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenyl] 2-methoxybenzoate |
|---|---|
| PubChem CID | 23962809 |
| Molecular Formula | C23H18N2O8 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | [4-[2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenyl] 2-methoxybenzoate |
| SMILES | COc1cc(C=Cc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])ccc1OC(=O)c1ccccc1OC |
| InChI | InChI=1S/C23H18N2O8/c1-31-20-6-4-3-5-18(20)23(26)33-21-12-8-15(13-22(21)32-2)7-9-16-10-11-17(24(27)28)14-19(16)25(29)30/h3-14H,1-2H3 |
| InChIKey | GSJOMRQXCJIMBK-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 131.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|