C20H12Br2N2O7S — CID 19205212
[4-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenyl] 4,5-dibromothiophene-2-carboxylate (PubChem CID 19205212) has the molecular formula C20H12Br2N2O7S and a molecular weight of 584.20 g/mol. Its IUPAC name is [4-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenyl] 4,5-dibromothiophene-2-carboxylate.
| Compound Name | [4-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenyl] 4,5-dibromothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19205212 |
| Molecular Formula | C20H12Br2N2O7S |
| Molecular Weight | 584.20 g/mol |
| Exact Mass | 581.87 |
| IUPAC Name | [4-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2-methoxyphenyl] 4,5-dibromothiophene-2-carboxylate |
| SMILES | COc1cc(/C=C/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])ccc1OC(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C20H12Br2N2O7S/c1-30-17-8-11(2-4-12-5-6-13(23(26)27)9-15(12)24(28)29)3-7-16(17)31-20(25)18-10-14(21)19(22)32-18/h2-10H,1H3/b4-2+ |
| InChIKey | JOKJSBHRJSLGLO-DUXPYHPUSA-N |
| XLogP | 6.49 |
| TPSA | 121.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.20 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|