C14H8N4O8 — CID 6106908
1-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2,4-dinitrobenzene (PubChem CID 6106908) has the molecular formula C14H8N4O8 and a molecular weight of 360.24 g/mol. Its IUPAC name is 1-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2,4-dinitrobenzene.
| Compound Name | 1-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2,4-dinitrobenzene |
|---|---|
| PubChem CID | 6106908 |
| Molecular Formula | C14H8N4O8 |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 360.03 |
| IUPAC Name | 1-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2,4-dinitrobenzene |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H8N4O8/c19-15(20)11-5-3-9(13(7-11)17(23)24)1-2-10-4-6-12(16(21)22)8-14(10)18(25)26/h1-8H/b2-1+ |
| InChIKey | RIXMHPATNAIPPM-OWOJBTEDSA-N |
| XLogP | 3.49 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|