C14H7Cl2N2O5- — CID 122232545
2,6-dichloro-4-[(E)-2-(2,4-dinitrophenyl)ethenyl]phenolate (PubChem CID 122232545) has the molecular formula C14H7Cl2N2O5- and a molecular weight of 354.13 g/mol. Its IUPAC name is 2,6-dichloro-4-[(E)-2-(2,4-dinitrophenyl)ethenyl]phenolate.
| Compound Name | 2,6-dichloro-4-[(E)-2-(2,4-dinitrophenyl)ethenyl]phenolate |
|---|---|
| PubChem CID | 122232545 |
| Molecular Formula | C14H7Cl2N2O5- |
| Molecular Weight | 354.13 g/mol |
| Exact Mass | 352.97 |
| IUPAC Name | 2,6-dichloro-4-[(E)-2-(2,4-dinitrophenyl)ethenyl]phenolate |
| SMILES | O=[N+]([O-])c1ccc(/C=C/c2cc(Cl)c([O-])c(Cl)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H8Cl2N2O5/c15-11-5-8(6-12(16)14(11)19)1-2-9-3-4-10(17(20)21)7-13(9)18(22)23/h1-7,19H/p-1/b2-1+ |
| InChIKey | WAWWFQAIMQFRGO-OWOJBTEDSA-M |
| XLogP | 4.05 |
| TPSA | 109.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.13 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|