C16H14N2O6 — CID 6263432
1-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2,3-dimethoxybenzene (PubChem CID 6263432) has the molecular formula C16H14N2O6 and a molecular weight of 330.30 g/mol. Its IUPAC name is 1-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2,3-dimethoxybenzene.
| Compound Name | 1-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2,3-dimethoxybenzene |
|---|---|
| PubChem CID | 6263432 |
| Molecular Formula | C16H14N2O6 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 1-[(E)-2-(2,4-dinitrophenyl)ethenyl]-2,3-dimethoxybenzene |
| SMILES | COc1cccc(/C=C/c2ccc([N+](=O)[O-])cc2[N+](=O)[O-])c1OC |
| InChI | InChI=1S/C16H14N2O6/c1-23-15-5-3-4-12(16(15)24-2)7-6-11-8-9-13(17(19)20)10-14(11)18(21)22/h3-10H,1-2H3/b7-6+ |
| InChIKey | TYIMHILMKDUTKI-VOTSOKGWSA-N |
| XLogP | 3.69 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|