C18H16N2O5S — CID 8861144
6-nitro-2-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]-1,3-benzothiazole (PubChem CID 8861144) has the molecular formula C18H16N2O5S and a molecular weight of 372.40 g/mol. Its IUPAC name is 6-nitro-2-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]-1,3-benzothiazole.
| Compound Name | 6-nitro-2-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 8861144 |
| Molecular Formula | C18H16N2O5S |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 6-nitro-2-[(E)-2-(2,3,4-trimethoxyphenyl)ethenyl]-1,3-benzothiazole |
| SMILES | COc1ccc(/C=C/c2nc3ccc([N+](=O)[O-])cc3s2)c(OC)c1OC |
| InChI | InChI=1S/C18H16N2O5S/c1-23-14-8-4-11(17(24-2)18(14)25-3)5-9-16-19-13-7-6-12(20(21)22)10-15(13)26-16/h4-10H,1-3H3/b9-5+ |
| InChIKey | JRTLSGXTIJLSNX-WEVVVXLNSA-N |
| XLogP | 4.40 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|