C17H14N2O2S — CID 5034143
2-[2-(2,5-dimethylphenyl)ethenyl]-6-nitro-1,3-benzothiazole (PubChem CID 5034143) has the molecular formula C17H14N2O2S and a molecular weight of 310.38 g/mol. Its IUPAC name is 2-[2-(2,5-dimethylphenyl)ethenyl]-6-nitro-1,3-benzothiazole.
| Compound Name | 2-[2-(2,5-dimethylphenyl)ethenyl]-6-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 5034143 |
| Molecular Formula | C17H14N2O2S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | 2-[2-(2,5-dimethylphenyl)ethenyl]-6-nitro-1,3-benzothiazole |
| SMILES | Cc1ccc(C)c(C=Cc2nc3ccc([N+](=O)[O-])cc3s2)c1 |
| InChI | InChI=1S/C17H14N2O2S/c1-11-3-4-12(2)13(9-11)5-8-17-18-15-7-6-14(19(20)21)10-16(15)22-17/h3-10H,1-2H3 |
| InChIKey | ICJYCDNOMSAMLL-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 56.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|