C8H4N2O3S — CID 20510506
6-nitro-1,3-benzothiazole-2-carbaldehyde (PubChem CID 20510506) has the molecular formula C8H4N2O3S and a molecular weight of 208.20 g/mol. Its IUPAC name is 6-nitro-1,3-benzothiazole-2-carbaldehyde.
| Compound Name | 6-nitro-1,3-benzothiazole-2-carbaldehyde |
|---|---|
| PubChem CID | 20510506 |
| Molecular Formula | C8H4N2O3S |
| Molecular Weight | 208.20 g/mol |
| Exact Mass | 207.99 |
| IUPAC Name | 6-nitro-1,3-benzothiazole-2-carbaldehyde |
| SMILES | O=Cc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C8H4N2O3S/c11-4-8-9-6-2-1-5(10(12)13)3-7(6)14-8/h1-4H |
| InChIKey | CLBAHSMUCIURDP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|