C22H12N6O4S2 — CID 71522068
(E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-[2-[(E)-(6-nitro-1,3-benzothiazol-2-yl)iminomethyl]phenyl]methanimine (PubChem CID 71522068) has the molecular formula C22H12N6O4S2 and a molecular weight of 488.51 g/mol. Its IUPAC name is (E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-[2-[(E)-(6-nitro-1,3-benzothiazol-2-yl)iminomethyl]phenyl]methanimine.
| Compound Name | (E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-[2-[(E)-(6-nitro-1,3-benzothiazol-2-yl)iminomethyl]phenyl]methanimine |
|---|---|
| PubChem CID | 71522068 |
| Molecular Formula | C22H12N6O4S2 |
| Molecular Weight | 488.51 g/mol |
| Exact Mass | 488.04 |
| IUPAC Name | (E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-[2-[(E)-(6-nitro-1,3-benzothiazol-2-yl)iminomethyl]phenyl]methanimine |
| SMILES | O=[N+]([O-])c1ccc2nc(/N=C/c3ccccc3/C=N/c3nc4ccc([N+](=O)[O-])cc4s3)sc2c1 |
| InChI | InChI=1S/C22H12N6O4S2/c29-27(30)15-5-7-17-19(9-15)33-21(25-17)23-11-13-3-1-2-4-14(13)12-24-22-26-18-8-6-16(28(31)32)10-20(18)34-22/h1-12H/b23-11+,24-12+ |
| InChIKey | DEXPQAHXEXZURZ-ASIDMNOUSA-N |
| XLogP | 6.22 |
| TPSA | 136.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.51 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|