C14H7Br2N3O3S — CID 1369006
2-bromo-6-[(6-bromo-1,3-benzothiazol-2-yl)iminomethyl]-4-nitrophenol (PubChem CID 1369006) has the molecular formula C14H7Br2N3O3S and a molecular weight of 457.10 g/mol. Its IUPAC name is 2-bromo-6-[(6-bromo-1,3-benzothiazol-2-yl)iminomethyl]-4-nitrophenol.
| Compound Name | 2-bromo-6-[(6-bromo-1,3-benzothiazol-2-yl)iminomethyl]-4-nitrophenol |
|---|---|
| PubChem CID | 1369006 |
| Molecular Formula | C14H7Br2N3O3S |
| Molecular Weight | 457.10 g/mol |
| Exact Mass | 454.86 |
| IUPAC Name | 2-bromo-6-[(6-bromo-1,3-benzothiazol-2-yl)iminomethyl]-4-nitrophenol |
| SMILES | O=[N+]([O-])c1cc(Br)c(O)c(C=Nc2nc3ccc(Br)cc3s2)c1 |
| InChI | InChI=1S/C14H7Br2N3O3S/c15-8-1-2-11-12(4-8)23-14(18-11)17-6-7-3-9(19(21)22)5-10(16)13(7)20/h1-6,20H |
| InChIKey | SPEVUZVMBRQIQE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.10 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|