C15H10BrN3O3S — CID 135615670
2-[(E)-(6-bromo-1,3-benzothiazol-2-yl)iminomethyl]-4-methyl-6-nitrophenol (PubChem CID 135615670) has the molecular formula C15H10BrN3O3S and a molecular weight of 392.23 g/mol. Its IUPAC name is 2-[(E)-(6-bromo-1,3-benzothiazol-2-yl)iminomethyl]-4-methyl-6-nitrophenol.
| Compound Name | 2-[(E)-(6-bromo-1,3-benzothiazol-2-yl)iminomethyl]-4-methyl-6-nitrophenol |
|---|---|
| PubChem CID | 135615670 |
| Molecular Formula | C15H10BrN3O3S |
| Molecular Weight | 392.23 g/mol |
| Exact Mass | 390.96 |
| IUPAC Name | 2-[(E)-(6-bromo-1,3-benzothiazol-2-yl)iminomethyl]-4-methyl-6-nitrophenol |
| SMILES | Cc1cc(/C=N/c2nc3ccc(Br)cc3s2)c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H10BrN3O3S/c1-8-4-9(14(20)12(5-8)19(21)22)7-17-15-18-11-3-2-10(16)6-13(11)23-15/h2-7,20H,1H3/b17-7+ |
| InChIKey | PTWTTYMHUBJRHX-REZTVBANSA-N |
| XLogP | 4.73 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.23 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|